meta-Glimepiride Impurity structure
|
Common Name | meta-Glimepiride Impurity | ||
|---|---|---|---|---|
| CAS Number | 791104-62-6 | Molecular Weight | 490.616 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C24H34N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-ethyl-3-methyl-N-[2-[3-[(4-methylcyclohexyl)carbamoylsulfamoyl]phenyl]ethyl]-5-oxo-2H-pyrrole-1-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Molecular Formula | C24H34N4O5S |
| Molecular Weight | 490.616 |
| Exact Mass | 490.224976 |
| PSA | 140.04000 |
| LogP | 2.94 |
| Index of Refraction | 1.599 |
| InChIKey | XBXROPCBZLGQMA-UHFFFAOYSA-N |
| SMILES | CCC1=C(C)CN(C(=O)NCCc2cccc(S(=O)(=O)NC(=O)NC3CCC(C)CC3)c2)C1=O |
| RIDADR | NONH for all modes of transport |
|---|
| 3-Ethyl-2,5-dihydro-4-methyl-N-[2-[3-[[[[(trans-4-methylcyclohexyl)amino]carbonyl]amino]sulfonyl]phenyl]ethyl]-2-oxo-1H-pyrrole-1-carboxamide |
| 3-Ethyl-4-methyl-N-[2-(3-{[(trans-4-methylcyclohexyl)carbamoyl]sulfamoyl}phenyl)ethyl]-2-oxo-2,5-dihydro-1H-pyrrole-1-carboxamide |
| 1-((3-(2-(((3-Ethyl-4-methyl-2-oxo-2,3-dihydro-1H-pyrrol-1-yl)carbonyl)amino)ethyl)phenyl)sulfonyl)-3-(trans-4-methylcyclohexyl)urea |
| meta-Glimepiride Impurity |
| Glimepride 3-Isomer |