2-hydroxy-5-(Methoxycarbonyl)benzoic acid structure
|
Common Name | 2-hydroxy-5-(Methoxycarbonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 79128-78-2 | Molecular Weight | 196.15700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-carboxy-4-methoxycarbonylphenolate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H8O5 |
|---|---|
| Molecular Weight | 196.15700 |
| Exact Mass | 196.03700 |
| PSA | 83.83000 |
| LogP | 0.87700 |
| InChIKey | LIQLYTSJSBMCAH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(O)c(C(=O)O)c1 |
| HS Code | 2918990090 |
|---|
|
~99%
2-hydroxy-5-(Me... CAS#:79128-78-2 |
| Literature: Miura, Masanori; Koike, Takanori; Ishihara, Tsukasa; Hirayama, Fukushi; Sakamoto, Shuichi; Okada, Minoru; Ohta, Mitsuaki; Tsukamoto, Shin-Ichi Synthetic Communications, 2006 , vol. 36, # 24 p. 3809 - 3820 |
|
~%
2-hydroxy-5-(Me... CAS#:79128-78-2 |
| Literature: Hunt et al. Journal of the Chemical Society, 1956 , p. 3099,3102 |
|
~%
2-hydroxy-5-(Me... CAS#:79128-78-2 |
| Literature: Hunt et al. Journal of the Chemical Society, 1956 , p. 3099,3102 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 1,3-Benzenedicarboxylic acid,4-hydroxy-,1-methyl ester |
| 4-Hydroxy-isophthalsaeure-1-methylester |
| methyl 3-carboxy-4-hydroxybenzoate |
| 2-hydroxy-5-(methoxycarbonyl)benzoic acid |
| 2-hydroxy-5-carbomethoxybenzoic acid |
| 4-hydroxy-isophthalic acid 1-methyl ester |
| 4-Hydroxy-isophthalsaeure-monomethylester-(1) |