5-bromo-1,3,3,4,4,5,6,6-octafluoro-2-nitrocyclohexene
Modify Date: 2025-08-26 12:14:23
5-bromo-1,3,3,4,4,5,6,6-octafluoro-2-nitrocyclohexene structure
|
Common Name | 5-bromo-1,3,3,4,4,5,6,6-octafluoro-2-nitrocyclohexene | ||
|---|---|---|---|---|
| CAS Number | 79150-80-4 | Molecular Weight | 349.96100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6BrF8NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-bromo-1,3,3,4,4,5,6,6-octafluoro-2-nitrocyclohexene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C6BrF8NO2 |
|---|---|
| Molecular Weight | 349.96100 |
| Exact Mass | 348.89800 |
| PSA | 45.82000 |
| LogP | 3.94760 |
| InChIKey | KBOSQAXWISYLKT-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])C1=C(F)C(F)(F)C(F)(Br)C(F)(F)C1(F)F |
|
~20%
5-bromo-1,3,3,4... CAS#:79150-80-4 |
| Literature: Bardin,V.V.; Furin,G.G. Journal of Fluorine Chemistry, 1983 , vol. 23, p. 67 |
|
~20%
5-bromo-1,3,3,4... CAS#:79150-80-4 |
| Literature: Bardin, V. V.; Furin G. G.; Yakobson, G. G. Journal of Organic Chemistry USSR (English Translation), 1981 , p. 879 - 884 Zhurnal Organicheskoi Khimii, 1981 , vol. 17, # 5 p. 999 - 1004 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Cyclohexene,4-bromo-2,3,3,4,5,5,6,6-octafluoro-1-nitro |
| 1-nitro-4-bromooctafluorocyclohexene |
| 4-bromo-1-nitrooctafluorocyclohexene |