WAY-313223-A structure
|
Common Name | WAY-313223-A | ||
|---|---|---|---|---|
| CAS Number | 79151-35-2 | Molecular Weight | 284.44 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22NS+ | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of WAY-313223-Ainhibiting NO production and TNFa and treating coronaviral infection |
| Name | WAY-313223-A |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H22NS+ |
|---|---|
| Molecular Weight | 284.44 |
| Exact Mass | 411.051758 |
| InChIKey | HRLPGBDVFSKHBF-OBBOLZQKSA-M |
| SMILES | CC[n+]1c(C=C2C=C(C)CC(C)C2)sc2ccccc21.[I-] |
| Benzothiazolium, 2-[(3,5-dimethyl-2-cyclohexen-1-ylidene)methyl]-3-ethyl-, iodide (1:1) |
| 2-[(3,5-Dimethyl-2-cyclohexen-1-ylidene)methyl]-3-ethyl-1,3-benzothiazol-3-ium iodide |