Isoquinoline,3,4-dihydro-6-methoxy-3-methyl-1-(trifluoromethyl)-, 2-oxide structure
|
Common Name | Isoquinoline,3,4-dihydro-6-methoxy-3-methyl-1-(trifluoromethyl)-, 2-oxide | ||
|---|---|---|---|---|
| CAS Number | 79205-08-6 | Molecular Weight | 259.22400 | |
| Density | 1.29g/cm3 | Boiling Point | 314.7ºC at 760mmHg | |
| Molecular Formula | C12H12F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.1ºC | |
| Name | 6-methoxy-3-methyl-2-oxido-1-(trifluoromethyl)-3,4-dihydroisoquinolin-2-ium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.29g/cm3 |
|---|---|
| Boiling Point | 314.7ºC at 760mmHg |
| Molecular Formula | C12H12F3NO2 |
| Molecular Weight | 259.22400 |
| Flash Point | 144.1ºC |
| Exact Mass | 259.08200 |
| PSA | 37.98000 |
| LogP | 2.46030 |
| Index of Refraction | 1.511 |
| InChIKey | KWRYRKSYRVHOFY-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CC(C)[N+]([O-])=C2C(F)(F)F |
|
~87%
Isoquinoline,3,... CAS#:79205-08-6 |
| Literature: Kawase; Kikugawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 6 p. 1615 - 1623 |
|
~%
Isoquinoline,3,... CAS#:79205-08-6 |
| Literature: Kawase; Kikugawa Chemical and Pharmaceutical Bulletin, 1981 , vol. 29, # 6 p. 1615 - 1623 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 6-methoxy-3-methyl-1-trifluoromethyl-3,4-dihydroisoquinoline 2-oxide |