12H-Indolo[1,2-b][1,2]benzothiazin-12-ol,12-phenyl-, 5,5-dioxide structure
|
Common Name | 12H-Indolo[1,2-b][1,2]benzothiazin-12-ol,12-phenyl-, 5,5-dioxide | ||
|---|---|---|---|---|
| CAS Number | 79253-81-9 | Molecular Weight | 361.41400 | |
| Density | 1.38g/cm3 | Boiling Point | 601ºC at 760mmHg | |
| Molecular Formula | C21H15NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 317.3ºC | |
| Name | 5,5-dioxo-12-phenylindolo[1,2-b][1,2]benzothiazin-12-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.38g/cm3 |
|---|---|
| Boiling Point | 601ºC at 760mmHg |
| Molecular Formula | C21H15NO3S |
| Molecular Weight | 361.41400 |
| Flash Point | 317.3ºC |
| Exact Mass | 361.07700 |
| PSA | 67.68000 |
| LogP | 4.55670 |
| Index of Refraction | 1.704 |
| InChIKey | XDDZOORJIBNUDA-UHFFFAOYSA-N |
| SMILES | O=S1(=O)c2ccccc2C(O)(c2ccccc2)c2cc3ccccc3n21 |
|
~%
12H-Indolo[1,2-... CAS#:79253-81-9 |
| Literature: Sundberg, Richard J.; Broome, Rita; Walters, Claudia Powers; Schnur, Dora Journal of Heterocyclic Chemistry, 1981 , vol. 18, p. 807 - 809 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 12-Phenyl-12H-indolo[1,2-b][1,2]benzothiazin-12-ol 5,5-dioxide |