1-(Phenylsulfonyl)-1H-indole structure
|
Common Name | 1-(Phenylsulfonyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 40899-71-6 | Molecular Weight | 257.308 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 451.6±28.0 °C at 760 mmHg | |
| Molecular Formula | C14H11NO2S | Melting Point | 78-80 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 226.9±24.0 °C | |
| Name | 1-(Phenylsulfonyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 451.6±28.0 °C at 760 mmHg |
| Melting Point | 78-80 °C(lit.) |
| Molecular Formula | C14H11NO2S |
| Molecular Weight | 257.308 |
| Flash Point | 226.9±24.0 °C |
| Exact Mass | 257.051056 |
| PSA | 47.45000 |
| LogP | 3.71 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | VDWLCYCWLIKWBV-UHFFFAOYSA-N |
| SMILES | O=S(=O)(c1ccccc1)n1ccc2ccccc21 |
| Hazard Codes | Xi |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2933990090 |
| Precursor 8 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
A direct lithiation route to 2-acyl-1-(phenylsulfonyl) indoles. Jiang J and Gribble GW.
Synth. Commun. 32(13) , 2035-40, (2002)
|
|
|
Synthesis of 1-(phenylsulfonyl) indol-3-YL trifluoromethanesulfonate. Conway SC and Gribble GW.
Heterocycles 30(1) , 627-33, (1990)
|
| N-(PHENYLSULFONYL)INDOLE |
| N-Phenylsulfonylindole |
| 1-(Phenylsulfonyl)indole |
| MFCD00134318 |
| 1-(Phenylsulfonyl) indole |
| 1-(benzenesulfonyl)indole |
| 1H-Indole, 1-(phenylsulfonyl)- |
| 1-(Benzenesulfonyl)indole Benzenesulfonic acid indolide |
| 1-(Phenylsulfonyl)-1H-indole |