2,4-Dibromo-16a-hydroxyestrone structure
|
Common Name | 2,4-Dibromo-16a-hydroxyestrone | ||
|---|---|---|---|---|
| CAS Number | 79258-14-3 | Molecular Weight | 444.15800 | |
| Density | 1.698g/cm3 | Boiling Point | 495.574ºC at 760 mmHg | |
| Molecular Formula | C18H20Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.514ºC | |
| Name | 2,4-Dibromo-16α-hydroxy Estrone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.698g/cm3 |
|---|---|
| Boiling Point | 495.574ºC at 760 mmHg |
| Molecular Formula | C18H20Br2O3 |
| Molecular Weight | 444.15800 |
| Flash Point | 253.514ºC |
| Exact Mass | 441.97800 |
| PSA | 57.53000 |
| LogP | 4.31320 |
| Index of Refraction | 1.647 |
| InChIKey | JTPNAPKUXFXZOQ-GYYZZVMYSA-N |
| SMILES | CC12CCC3c4cc(Br)c(O)c(Br)c4CCC3C1CC(O)C2=O |
|
~99%
2,4-Dibromo-16a... CAS#:79258-14-3 |
| Literature: Numazawa, Mitsuteru; Nagaoka, Masao; Tsuji, Masachika; Osawa, Yoshio Journal of the Chemical Society, Chemical Communications, 1981 , # 8 p. 383 - 384 |
|
~%
2,4-Dibromo-16a... CAS#:79258-14-3 |
| Literature: Numazawa, Mitsuteru; Nagaoka, Masao; Tsuji, Masachika; Osawa, Yoshio Journal of the Chemical Society, Chemical Communications, 1981 , # 8 p. 383 - 384 |
| 2,4-Dibromo-16a-hydroxyestrone |
| 2,3-DISULFO-4,4'-DIFLUOROBENZOPHENONE |
| 2,4-Dibromo-3,16a-dihydroxyestra-1,3,5(10)-trien-17-one (16a)-2,4-Dibromo-3,16-dihydroxyestra-1,3,5(10)-trien-17-one |