2,4-Dibromo-17,17-ethylenedioxy-1,3,5(10)-estratriene-3,16a-diol structure
|
Common Name | 2,4-Dibromo-17,17-ethylenedioxy-1,3,5(10)-estratriene-3,16a-diol | ||
|---|---|---|---|---|
| CAS Number | 90474-20-7 | Molecular Weight | 488.21000 | |
| Density | 1.75g/cm3 | Boiling Point | 533.533ºC at 760 mmHg | |
| Molecular Formula | C20H24Br2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 276.471ºC | |
| Name | 2,4-Dibromo-17,17-ethylenedioxy-1,3,5(10)-estratriene-3,16α-diol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 533.533ºC at 760 mmHg |
| Molecular Formula | C20H24Br2O4 |
| Molecular Weight | 488.21000 |
| Flash Point | 276.471ºC |
| Exact Mass | 486.00400 |
| PSA | 58.92000 |
| LogP | 4.48720 |
| Index of Refraction | 1.679 |
| InChIKey | GUKVLVMQIYQXIM-UHFFFAOYSA-N |
| SMILES | CC12CCC3c4cc(Br)c(O)c(Br)c4CCC3C1CC(O)C21OCCO1 |
|
~72%
2,4-Dibromo-17,... CAS#:90474-20-7 |
| Literature: Numazawa; Nagaoka; Ogata Chemical and Pharmaceutical Bulletin, 1984 , vol. 32, # 2 p. 618 - 622 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2,4-Dibromo-17,17-ethylenedioxy-1,3,5(10)-estratriene-3,16a-diol |
| (16a)-2,4-Dibromo-3,16-dihydroxyestra-1,3,5(10)-trien-17-one Cyclic 1,2-Ethanediyl Acetal |
| 2,3-DITHIA-5,7-DIAZABICYCLO[2.2.2]OCTANE-6,8-DIONE |