2,5-BISTRIMETHYLSILANYLTHIAZOLE structure
|
Common Name | 2,5-BISTRIMETHYLSILANYLTHIAZOLE | ||
|---|---|---|---|---|
| CAS Number | 79265-34-2 | Molecular Weight | 229.49000 | |
| Density | 0.94g/cm3 | Boiling Point | 100ºC/13mm | |
| Molecular Formula | C9H19NSSi2 | Melting Point | 53-56ºC | |
| MSDS | Chinese USA | Flash Point | >230 °F | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-Bis(trimethylsilyl)thiazole |
|---|---|
| Synonym | More Synonyms |
| Density | 0.94g/cm3 |
|---|---|
| Boiling Point | 100ºC/13mm |
| Melting Point | 53-56ºC |
| Molecular Formula | C9H19NSSi2 |
| Molecular Weight | 229.49000 |
| Exact Mass | 229.07800 |
| PSA | 41.13000 |
| LogP | 2.23350 |
| Index of Refraction | 1.472 |
| InChIKey | RZHDOWFVGMFXMC-UHFFFAOYSA-N |
| SMILES | C[Si](C)(C)c1cnc([Si](C)(C)C)s1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2934100090 |
| Flash Point(F) | >230 °F |
| Flash Point(C) | >110 °C |
|
~42%
2,5-BISTRIMETHY... CAS#:79265-34-2 |
| Literature: Tetrahedron Letters, , vol. 49, # 1 p. 66 - 69 |
|
~39%
2,5-BISTRIMETHY... CAS#:79265-34-2 |
| Literature: Journal of the Chemical Society, Chemical Communications, , # 13 p. 655 - 656 |
|
~%
2,5-BISTRIMETHY... CAS#:79265-34-2 |
| Literature: Journal of Organic Chemistry, , vol. 53, # 8 p. 1748 - 1761 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| trimethyl-(2-trimethylsilyl-1,3-thiazol-5-yl)silane |
| MFCD09800395 |