N-(benzhydrylideneamino)-2-chloro-propanamide structure
|
Common Name | N-(benzhydrylideneamino)-2-chloro-propanamide | ||
|---|---|---|---|---|
| CAS Number | 79289-07-9 | Molecular Weight | 286.75600 | |
| Density | 1.15g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(benzhydrylideneamino)-2-chloropropanamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.15g/cm3 |
|---|---|
| Molecular Formula | C16H15ClN2O |
| Molecular Weight | 286.75600 |
| Exact Mass | 286.08700 |
| PSA | 41.46000 |
| LogP | 3.57340 |
| Index of Refraction | 1.579 |
| InChIKey | PYSXPMVOUHMGEC-UHFFFAOYSA-N |
| SMILES | CC(Cl)C(=O)NN=C(c1ccccc1)c1ccccc1 |
|
~93%
N-(benzhydrylid... CAS#:79289-07-9 |
| Literature: Taylor,E.C.; Haley,N.F.; Clemens,R.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 7743 |
| hms2698e05 |
| 9n-360s |