WAY-301464
Modify Date: 2024-04-05 16:31:35
WAY-301464 structure
|
Common Name | WAY-301464 | ||
|---|---|---|---|---|
| CAS Number | 79492-49-2 | Molecular Weight | 287.31532 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 543.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C18H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 282.4±30.1 °C | |
Use of WAY-301464Pim-1 inhibitor |
| Name | WAY-301464 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 543.3±50.0 °C at 760 mmHg |
| Molecular Formula | C18H13N3O |
| Molecular Weight | 287.31532 |
| Flash Point | 282.4±30.1 °C |
| Exact Mass | 287.105865 |
| LogP | 3.85 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.717 |
| InChIKey | VVFRJCXNTHXSOG-UHFFFAOYSA-N |
| SMILES | N#Cc1c(-c2ccccc2)cc(-c2ccc(O)cc2)nc1N |
| 3-Pyridinecarbonitrile, 2-amino-6-(4-hydroxyphenyl)-4-phenyl- |
| 2-Amino-6-(4-hydroxy-phenyl)-4-phenyl-nicotinonitrile |
| 2-Amino-6-(4-hydroxyphenyl)-4-phenylnicotinonitrile |
| 2-amino-6-(4-hydroxyphenyl)-4-phenylpyridine-3-carbonitrile |