4-allyl-2,3,5,6-tetrafluorobenzoic acid structure
|
Common Name | 4-allyl-2,3,5,6-tetrafluorobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 79538-02-6 | Molecular Weight | 234.14700 | |
| Density | 1.434g/cm3 | Boiling Point | 253.9ºC at 760 mmHg | |
| Molecular Formula | C10H6F4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 107.4ºC | |
| Name | 2,3,5,6-tetrafluoro-4-prop-2-enylbenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.434g/cm3 |
|---|---|
| Boiling Point | 253.9ºC at 760 mmHg |
| Molecular Formula | C10H6F4O2 |
| Molecular Weight | 234.14700 |
| Flash Point | 107.4ºC |
| Exact Mass | 234.03000 |
| PSA | 37.30000 |
| LogP | 2.66970 |
| Index of Refraction | 1.488 |
| InChIKey | INABVTWXXDFTOB-UHFFFAOYSA-N |
| SMILES | C=CCc1c(F)c(F)c(C(=O)O)c(F)c1F |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2916399090 |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| MFCD00082610 |
| 4-Allyl-2,3,5,6-tetrafluorobenzoic acid |
| PC1006T |