1,3-Difluoro-2-methyl-4-nitrobenzene structure
|
Common Name | 1,3-Difluoro-2-methyl-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 79562-49-5 | Molecular Weight | 173.117 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 237.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H5F2NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 108.8±14.2 °C | |
| Name | 1,3-Difluoro-2-methyl-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 237.2±35.0 °C at 760 mmHg |
| Molecular Formula | C7H5F2NO2 |
| Molecular Weight | 173.117 |
| Flash Point | 108.8±14.2 °C |
| Exact Mass | 173.028839 |
| PSA | 45.82000 |
| LogP | 2.04 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | AVWNNVJXXMKAPB-UHFFFAOYSA-N |
| SMILES | Cc1c(F)ccc([N+](=O)[O-])c1F |
| Hazard Codes | T+ |
|---|---|
| RIDADR | 2811.0 |
| HS Code | 2904909090 |
|
~83%
1,3-Difluoro-2-... CAS#:79562-49-5 |
| Literature: Tani; Mushika; Yamaguchi Chemical and Pharmaceutical Bulletin, 1982 , vol. 30, # 10 p. 3530 - 3543 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 1,3-Difluoro-2-methyl-4-nitrobenzene |