2,3-Dihydrobenzofuran-5-ethanol Tosylate
2,3-Dihydrobenzofuran-5-ethanol Tosylate structure
|
Common Name | 2,3-Dihydrobenzofuran-5-ethanol Tosylate | ||
|---|---|---|---|---|
| CAS Number | 79679-49-5 | Molecular Weight | 318.38700 | |
| Density | 1.267g/cm3 | Boiling Point | 491.7ºC at 760 mmHg | |
| Molecular Formula | C17H18O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.1ºC | |
Summary: 2,3-Dihydrobenzofuran-5-ethanol Tosylate (2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate)，Chinese name: 2,3-二氢苯并呋喃-5-乙醇对甲苯磺酸酯，CAS number: 79679-49-5，molecular formula: C17H18O4S，molecular weight: 318.38700，for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.267g/cm3 |
|---|---|
| Boiling Point | 491.7ºC at 760 mmHg |
| Molecular Formula | C17H18O4S |
| Molecular Weight | 318.38700 |
| Flash Point | 251.1ºC |
| Exact Mass | 318.09300 |
| PSA | 60.98000 |
| LogP | 3.95870 |
| Index of Refraction | 1.59 |
| InChIKey | DKYSYGFCWXQFGH-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCc2ccc3c(c2)CCO3)cc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2932999099 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2,3-Dihydrobenz... CAS#:79679-49-5 |
| Literature: EP999205 A1, ; EP 0999205 A1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Darifenacin Intermediate 3 |
| 5-(2-tosyloxyethyl)-2,3-dihydrobenzofuran |
| 2,3-Dihydrobenzofuran-5-ethanol Tosylate |
| 2-(2,3-dihydrobenzofuran-5-yl)ethyl tosylate |
| 2-(2,3-dihidrobenzofuran-5-yl)ethyl tosylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: Molecular formula of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is C17H18O4S. |
| Q: What is the SMILES notation of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: SMILES notation of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCCc2ccc3c(c2)CCO3)cc1. |
| Q: What is the boiling point of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: Boiling point of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is 491.7ºC at 760 mmHg. |
| Q: What is the LogP of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: LogP of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is 3.95870. |
| Q: What are the upstream materials of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: Related upstream materials(CAS) of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate: 87776-76-9;98-59-9. |
| Q: What is the InChIKey of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: InChIKey of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is DKYSYGFCWXQFGH-UHFFFAOYSA-N. |
| Q: What is the English name of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: The English name of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate. |
| Q: What is the molecular weight of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: Molecular weight of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is 318.38700. |
| Q: What English synonyms does 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate have? |
| A: English synonyms of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate: Darifenacin Intermediate 3, 5-(2-tosyloxyethyl)-2,3-dihydrobenzofuran, 2,3-Dihydrobenzofuran-5-ethanol Tosylate, 2-(2,3-dihydrobenzofuran-5-yl)ethyl tosylate, 2-(2,3-dihidrobenzofuran-5-yl)ethyl tosylate. |
| Q: What is the CAS number of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate? |
| A: CAS number of 2-(2,3-Dihydrobenzofuran-5-yl)ethyl 4-methylbenzenesulfonate is 79679-49-5. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |