2-(4-Chlorosulfonylphenyl)ethyltrimethoxysilane structure
|
Common Name | 2-(4-Chlorosulfonylphenyl)ethyltrimethoxysilane | ||
|---|---|---|---|---|
| CAS Number | 79793-00-3 | Molecular Weight | 338.110 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 365.6±35.0 °C at 760 mmHg | |
| Molecular Formula | C8H8Cl4O2SSi | Melting Point | <0ºC | |
| MSDS | N/A | Flash Point | 174.9±25.9 °C | |
| Name | 4-(2-trichlorosilylethyl)benzenesulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.6±35.0 °C at 760 mmHg |
| Melting Point | <0ºC |
| Molecular Formula | C8H8Cl4O2SSi |
| Molecular Weight | 338.110 |
| Flash Point | 174.9±25.9 °C |
| Exact Mass | 335.876831 |
| PSA | 42.52000 |
| LogP | 6.15 |
| Appearance of Characters | Solution | Clear yellow |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.550 |
| InChIKey | IHBDUARGLPMOND-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Cl)c1ccc(CC[Si](Cl)(Cl)Cl)cc1 |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | R40 |
| Safety Phrases | 45-36/37/39-26 |
| RIDADR | UN 2987 |
| 4-[2-(Trichlorosilyl)ethyl]benzenesulfonyl chloride |
| MFCD00054773 |
| Benzenesulfonyl chloride, 4-(2-(trichlorosilyl)ethyl)- |
| einecs 279-267-2 |
| p-(2-(Trichlorosilyl)ethyl)benzenesulphonyl chloride |
| Benzenesulfonyl chloride, 4-[2-(trichlorosilyl)ethyl]- |