3-amino-6-nitro-chromen-2-one structure
|
Common Name | 3-amino-6-nitro-chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 79892-85-6 | Molecular Weight | 206.15500 | |
| Density | 1.532g/cm3 | Boiling Point | 454.3ºC at 760 mmHg | |
| Molecular Formula | C9H6N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.5ºC | |
| Name | 3-amino-6-nitrochromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532g/cm3 |
|---|---|
| Boiling Point | 454.3ºC at 760 mmHg |
| Molecular Formula | C9H6N2O4 |
| Molecular Weight | 206.15500 |
| Flash Point | 228.5ºC |
| Exact Mass | 206.03300 |
| PSA | 102.05000 |
| LogP | 2.38780 |
| Index of Refraction | 1.663 |
| InChIKey | JQARZSMORFTYHY-UHFFFAOYSA-N |
| SMILES | Nc1cc2cc([N+](=O)[O-])ccc2oc1=O |
|
~72%
3-amino-6-nitro... CAS#:79892-85-6 |
| Literature: Warner-Lambert Company Patent: US4287126 A1, 1981 ; |
|
~99%
3-amino-6-nitro... CAS#:79892-85-6 |
| Literature: Bonsignore, Leonardo; Loy, Giuseppe Journal of Heterocyclic Chemistry, 1998 , vol. 35, # 1 p. 117 - 119 |
|
~%
3-amino-6-nitro... CAS#:79892-85-6 |
| Literature: Kudale, Amit A.; Kendall, Jamie; Warford, C. Chad; Wilkins, Natasha D.; Bodwell, Graham J. Tetrahedron Letters, 2007 , vol. 48, # 29 p. 5077 - 5080 |
|
~%
3-amino-6-nitro... CAS#:79892-85-6 |
| Literature: Bonsignore, Leonardo; Loy, Giuseppe Journal of Heterocyclic Chemistry, 1998 , vol. 35, # 1 p. 117 - 119 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-amino-6-nitro-chromen-2-one |
| HMS544E07 |
| 3-amino-6-nitrocoumarin |
| 3-amino-6-nitro-2H-chromen-2-one |
| 6-nitro-3-aminocoumarin |