2-[(2-hydroxy-5-tert-butyl-phenyl)methyl]-4-tert-butyl-phenol structure
|
Common Name | 2-[(2-hydroxy-5-tert-butyl-phenyl)methyl]-4-tert-butyl-phenol | ||
|---|---|---|---|---|
| CAS Number | 799-13-3 | Molecular Weight | 312.44600 | |
| Density | 1.044g/cm3 | Boiling Point | 434.6ºC at 760 mmHg | |
| Molecular Formula | C21H28O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | 4-tert-butyl-2-[(5-tert-butyl-2-hydroxyphenyl)methyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.044g/cm3 |
|---|---|
| Boiling Point | 434.6ºC at 760 mmHg |
| Molecular Formula | C21H28O2 |
| Molecular Weight | 312.44600 |
| Flash Point | 191.3ºC |
| Exact Mass | 312.20900 |
| PSA | 40.46000 |
| LogP | 5.28360 |
| Index of Refraction | 1.555 |
| InChIKey | RXAGDDKHRDAVLM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(O)c(Cc2cc(C(C)(C)C)ccc2O)c1 |
|
Name: Determination of Inhibitory Potencies by Coupled ATPase Activity Assay from Article 1...
Source: BindingDB
Target: N/A
External Id: BindingDB_3449_1
|
|
Name: Inhibition of rabbit hind leg tissue microsomes ATPase activity of SERCA assessed as ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1036525
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 4,4'-Di-tert-butyl-2,2'-methandiyl-di-phenol |
| bis(5-tert-butyl-2-hydroxyphenyl)methane |
| Bis-(6-hydroxy-3-tert.-butyl-phenyl)-methan |
| 2,2'-METHANEDIYLBIS(4-TERT-BUTYLPHENOL) |
| 4,4'-di-tert-butyl-2,2'-dihydroxybiphenyl |
| 4,4'-di-tert-butyl-2,2'-methanediyldiphenol |