Ethyl 5-methyl-3,4-dioxo-2,3,4,5-tetrahydrothieno(3,2-c)quinoline-2-carboxylate structure
|
Common Name | Ethyl 5-methyl-3,4-dioxo-2,3,4,5-tetrahydrothieno(3,2-c)quinoline-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 79966-23-7 | Molecular Weight | 303.33300 | |
| Density | 1.43g/cm3 | Boiling Point | 455.5ºC at 760 mmHg | |
| Molecular Formula | C15H13NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 229.3ºC | |
| Name | ethyl 5-methyl-3,4-dioxothieno[3,2-c]quinoline-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 455.5ºC at 760 mmHg |
| Molecular Formula | C15H13NO4S |
| Molecular Weight | 303.33300 |
| Flash Point | 229.3ºC |
| Exact Mass | 303.05700 |
| PSA | 90.67000 |
| LogP | 1.75860 |
| Index of Refraction | 1.658 |
| InChIKey | QELINHNPPVGWTK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1Sc2c(c(=O)n(C)c3ccccc23)C1=O |
|
~37%
Ethyl 5-methyl-... CAS#:79966-23-7 |
| Literature: Coppola; Hardtmann Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 5 p. 917 - 920 |
|
~%
Ethyl 5-methyl-... CAS#:79966-23-7 |
| Literature: Coppola; Hardtmann Journal of Heterocyclic Chemistry, 1981 , vol. 18, # 5 p. 917 - 920 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Ethyl 5-methyl-3,4-dioxo-2,3,4,5-tetrahydrothieno(3,2-c)quinoline-2-carboxylate |
| 2,3,4,5-tetrahydro-5-methyl-3,4-dioxothieno<3,2-c>quinoline-2-carboxylic acid ethyl ester |