2-[2-(2-dimethylaminoethyl-methyl-amino)ethyl]isoindole-1,3-dione structure
|
Common Name | 2-[2-(2-dimethylaminoethyl-methyl-amino)ethyl]isoindole-1,3-dione | ||
|---|---|---|---|---|
| CAS Number | 79975-06-7 | Molecular Weight | 275.34600 | |
| Density | 1.16g/cm3 | Boiling Point | 377.6ºC at 760mmHg | |
| Molecular Formula | C15H21N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 151.4ºC | |
| Name | 2-[2-[2-(dimethylamino)ethyl-methylamino]ethyl]isoindole-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.16g/cm3 |
|---|---|
| Boiling Point | 377.6ºC at 760mmHg |
| Molecular Formula | C15H21N3O2 |
| Molecular Weight | 275.34600 |
| Flash Point | 151.4ºC |
| Exact Mass | 275.16300 |
| PSA | 43.86000 |
| LogP | 0.71390 |
| InChIKey | HQFMONJVKGNTCY-UHFFFAOYSA-N |
| SMILES | CN(C)CCN(C)CCN1C(=O)c2ccccc2C1=O |
|
~22%
2-[2-(2-dimethy... CAS#:79975-06-7 |
| Literature: Ford, H.; Chang, C.-H.; Behrman, E.J. Journal of the American Chemical Society, 1981 , vol. 103, # 26 p. 7773 - 7779 |
|
~%
2-[2-(2-dimethy... CAS#:79975-06-7 |
| Literature: Ford, H.; Chang, C.-H.; Behrman, E.J. Journal of the American Chemical Society, 1981 , vol. 103, # 26 p. 7773 - 7779 |
| 2-[2-[2-dimethylaminoethyl(methyl)amino]ethyl]isoindole-1,3-dione |
| N,N,N'-trimethyl-N'-(2-(N-phthalimido)ethyl)ethylenediamine |