4,4'-Isopropylidenedicyclohexanol structure
|
Common Name | 4,4'-Isopropylidenedicyclohexanol | ||
|---|---|---|---|---|
| CAS Number | 80-04-6 | Molecular Weight | 240.382 | |
| Density | 1.048±0.06 g/cm3 | Boiling Point | 230-234 °C14 mm Hg(lit.) | |
| Molecular Formula | C15H28O2 | Melting Point | 187 °C(Solv: benzene (71-43-2); ethanol (64-17-5)) | |
| MSDS | Chinese USA | Flash Point | 151.7±13.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4,4'-(Propane-2,2-diyl)dicyclohexanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.048±0.06 g/cm3 |
|---|---|
| Boiling Point | 230-234 °C14 mm Hg(lit.) |
| Melting Point | 187 °C(Solv: benzene (71-43-2); ethanol (64-17-5)) |
| Molecular Formula | C15H28O2 |
| Molecular Weight | 240.382 |
| Flash Point | 151.7±13.6 °C |
| Exact Mass | 240.208923 |
| PSA | 40.46000 |
| LogP | 3.08 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.524 |
| InChIKey | CDBAMNGURPMUTG-UHFFFAOYSA-N |
| SMILES | CC(C)(C1CCC(O)CC1)C1CCC(O)CC1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H319 |
| Precautionary Statements | P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36 |
| Safety Phrases | S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2906199090 |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 4,4'-(2,2-Propanediyl)dicyclohexanol |
| 4-[2-(4-hydroxycyclohexyl)propan-2-yl]cyclohexan-1-ol |
| MFCD00019334 |
| Hydrogenated bisphenol A; 4,4'-isopropylidenedicyclohexanol |
| 1,1'-Isopropylidenebis(4-cyclohexanol) |
| 4,4'-Propane-2,2-diyldicyclohexanol |
| Cyclohexanol, 4,4'-(1-methylethylidene)bis- |
| EINECS 201-244-2 |
| 2,2-Bis(4-hydroxycyclohexyl)propane |
| L6TJ AQ DX1&1&- AL6TJ DQ |