Sulfonated castor oil structure
|
Common Name | Sulfonated castor oil | ||
|---|---|---|---|---|
| CAS Number | 8002-33-3 | Molecular Weight | 422.488 | |
| Density | 1.06 g/mL at 20 °C | Boiling Point | N/A | |
| Molecular Formula | C18H32Na2O6S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 109 °C | |
Use of Sulfonated castor oilSulfonated castor oil is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | Turkey red oil sodium salt |
|---|---|
| Synonym | More Synonyms |
| Description | Sulfonated castor oil is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.06 g/mL at 20 °C |
|---|---|
| Molecular Formula | C18H32Na2O6S |
| Molecular Weight | 422.488 |
| Flash Point | 109 °C |
| Exact Mass | 422.171509 |
| PSA | 125.94000 |
| LogP | 3.35070 |
| InChIKey | GBHFRFNAIRYOIZ-WHYMNKIFSA-L |
| SMILES | O=C([O-])CCCCCCCC=CCC(O)CCCCCCS(=O)(=O)[O-].[Na+].[Na+] |
| Storage condition | 2-8°C |
CHEMICAL IDENTIFICATION
|
| Hazard Codes | Xi:Irritant |
|---|---|
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| RTECS | YO8300000 |
| Sulfonated castor oil |
| Disodium (9Z,12R)-12-hydroxy-18-sulfonato-9-octadecenoate |
| 9-Octadecenoic acid, 12-hydroxy-18-sulfo-, sodium salt, (9Z,12R)- (1:2) |
| EINECS 232-306-7 |
| MFCD00132540 |