9,10-bis[2-(4-methoxyphenyl)ethynyl]anthracene-9,10-diol structure
|
Common Name | 9,10-bis[2-(4-methoxyphenyl)ethynyl]anthracene-9,10-diol | ||
|---|---|---|---|---|
| CAS Number | 80034-18-0 | Molecular Weight | 472.53100 | |
| Density | 1.34g/cm3 | Boiling Point | 702.5ºC at 760 mmHg | |
| Molecular Formula | C32H24O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 378.6ºC | |
| Name | 9,10-bis[2-(4-methoxyphenyl)ethynyl]anthracene-9,10-diol |
|---|
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 702.5ºC at 760 mmHg |
| Molecular Formula | C32H24O4 |
| Molecular Weight | 472.53100 |
| Flash Point | 378.6ºC |
| Exact Mass | 472.16700 |
| PSA | 58.92000 |
| LogP | 4.59240 |
| Index of Refraction | 1.715 |
| InChIKey | OYEFWGPZRBMIBJ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C#CC2(O)c3ccccc3C(O)(C#Cc3ccc(OC)cc3)c3ccccc32)cc1 |
|
~%
9,10-bis[2-(4-m... CAS#:80034-18-0 |
| Literature: Hanhela, Peter J.; Paul, Brenton D. Australian Journal of Chemistry, 1981 , vol. 34, # 8 p. 1701 - 1717 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |