2,5,6-trichloro-1h-indole-3-carbaldehyde
2,5,6-trichloro-1h-indole-3-carbaldehyde structure
|
Common Name | 2,5,6-trichloro-1h-indole-3-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 800400-47-9 | Molecular Weight | 248.49300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H4Cl3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 2,5,6-trichloro-1H-indole-3-carbaldehyde, Chinese name: 2,5,6-三氯-1H-吲哚-3-甲醛, CAS number: 800400-47-9, molecular formula: C9H4Cl3NO, molecular weight: 248.49300, for research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,5,6-trichloro-1h-indole-3-carbaldehyde |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H4Cl3NO |
|---|---|
| Molecular Weight | 248.49300 |
| Exact Mass | 246.93600 |
| PSA | 32.86000 |
| LogP | 3.94060 |
| InChIKey | JHNMIGWYZMQLOQ-UHFFFAOYSA-N |
| SMILES | O=Cc1c(Cl)[nH]c2cc(Cl)c(Cl)cc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~73%
2,5,6-trichloro... CAS#:800400-47-9 |
| Literature: Williams, John D.; Ptak, Roger G.; Drach, John C.; Townsend, Leroy B. Journal of Medicinal Chemistry, 2004 , vol. 47, # 23 p. 5773 - 5782 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1H-Indole-3-carboxaldehyde,2,5,6-trichloro |
| 3-formyl-2,5,6-trichloroindole |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: InChIKey of 2,5,6-trichloro-1h-indole-3-carbaldehyde is JHNMIGWYZMQLOQ-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: CAS number of 2,5,6-trichloro-1h-indole-3-carbaldehyde is 800400-47-9. |
| Q: What is the LogP of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: LogP of 2,5,6-trichloro-1h-indole-3-carbaldehyde is 3.94060. |
| Q: What is the SMILES notation of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: SMILES notation of 2,5,6-trichloro-1h-indole-3-carbaldehyde is O=Cc1c(Cl)[nH]c2cc(Cl)c(Cl)cc12. |
| Q: What is the molecular formula of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: Molecular formula of 2,5,6-trichloro-1h-indole-3-carbaldehyde is C9H4Cl3NO. |
| Q: What is the polar surface area (PSA) of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: Polar surface area (PSA) of 2,5,6-trichloro-1h-indole-3-carbaldehyde is 32.86000. |
| Q: What English synonyms does 2,5,6-trichloro-1h-indole-3-carbaldehyde have? |
| A: English synonyms of 2,5,6-trichloro-1h-indole-3-carbaldehyde: 1H-Indole-3-carboxaldehyde,2,5,6-trichloro, 3-formyl-2,5,6-trichloroindole. |
| Q: What is the molecular weight of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: Molecular weight of 2,5,6-trichloro-1h-indole-3-carbaldehyde is 248.49300. |
| Q: What is the English name of 2,5,6-trichloro-1h-indole-3-carbaldehyde? |
| A: The English name of 2,5,6-trichloro-1h-indole-3-carbaldehyde is 2,5,6-trichloro-1h-indole-3-carbaldehyde. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |