1,3-bis(2-hydroxyhexafluoroisopropyl)benzene structure
|
Common Name | 1,3-bis(2-hydroxyhexafluoroisopropyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 802-93-7 | Molecular Weight | 410.156 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 303.9±42.0 °C at 760 mmHg | |
| Molecular Formula | C12H6F12O2 | Melting Point | 41892ºC | |
| MSDS | N/A | Flash Point | 97.2±0.0 °C | |
| Name | 1,3-Bis(hexafluoro-α-hydroxyisopropyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 303.9±42.0 °C at 760 mmHg |
| Melting Point | 41892ºC |
| Molecular Formula | C12H6F12O2 |
| Molecular Weight | 410.156 |
| Flash Point | 97.2±0.0 °C |
| Exact Mass | 410.017609 |
| PSA | 40.46000 |
| LogP | 5.35 |
| Vapour Pressure | 0.0±0.7 mmHg at 25°C |
| Index of Refraction | 1.385 |
| InChIKey | PGUIOHNOYADLMU-UHFFFAOYSA-N |
| SMILES | OC(c1cccc(C(O)(C(F)(F)F)C(F)(F)F)c1)(C(F)(F)F)C(F)(F)F |
| Water Solubility | Difficult to mix. |
| Hazard Codes | Xi,C |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37-S39 |
| RIDADR | UN 3265 |
| WGK Germany | 3 |
| RTECS | 212-354-5 |
|
~87%
1,3-bis(2-hydro... CAS#:802-93-7 |
| Literature: Sepiol, Janiusz; Soulen, Robert L. Journal of Fluorine Chemistry, 1984 , vol. 24, p. 61 - 74 |
|
~53%
1,3-bis(2-hydro... CAS#:802-93-7
Detail
|
| Literature: Journal of Fluorine Chemistry, , vol. 24, p. 61 - 74 |
| EINECS 212-354-5 |
| 2,2'-(1,3-Phenylene)bis(1,1,1,3,3,3-hexafluoro-2-propanol) |
| a,a,a',a'-tetrakis(trifluoromethyl)-1,3-benzenedimethanol |
| MFCD00042090 |
| 1,1,1,3,3,3-hexafluoro-2-[3-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)phenyl]propan-2-ol |
| 2,2'-(1,3-phenylene)bis(1,1,1,3,3,3-hexafluoropropan-2-ol) |