Lycopodium structure
|
Common Name | Lycopodium | ||
|---|---|---|---|---|
| CAS Number | 8023-70-9 | Molecular Weight | N/A | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | (ClubMossSpores) | Melting Point | N/A | |
| MSDS | USA | Flash Point | N/A | |
| Symbol |
GHS02 |
Signal Word | Danger | |
| Name | LYCOPODIUM |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | (ClubMossSpores) |
|---|---|
| InChIKey | GDOJDJJOSBIYKU-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1O)C1=CC3CC4(CCC(Cn5ccc6[nH]ccc65)C4)C4CC(O)CCC4C3C2CC(=O)CC(CCc2ccc(O)c(OCCO)c2)OC(=O)CC#CCc2c1[nH]c1ccccc21 |
| Stability | Stable. Incompatible with strong oxidizing agents. The dust can form an explosive combination with air. |
| Symbol |
GHS02 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H228 |
| Precautionary Statements | P210 |
| Personal Protective Equipment | Eyeshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | F |
| Risk Phrases | 11 |
| Safety Phrases | 16 |
| RIDADR | UN 1325 4.1/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 4.1 |
|
The lycopodium alkaloids.
Nat. Prod. Rep. 8(5) , 455-63, (1991)
|
|
|
[Galenical preparations from lycopodium oil (author's transl)].
J. Pharm. Belg. 35(3) , 226-32, (1980)
|
|
|
[Coating assays of a granulate containing lycopodium oil (author's transl)].
J. Pharm. Belg. 36(2) , 97-102, (1981)
|
| EINECS 282-002-3 |