2,4-dimethylpent-2-en-3-yloxy(triethyl)silane
2,4-dimethylpent-2-en-3-yloxy(triethyl)silane structure
|
Common Name | 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane | ||
|---|---|---|---|---|
| CAS Number | 80239-20-9 | Molecular Weight | 228.44600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H28OSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C13H28OSi |
|---|---|
| Molecular Weight | 228.44600 |
| Exact Mass | 228.19100 |
| PSA | 9.23000 |
| LogP | 4.95810 |
| InChIKey | UXXRCYQQOOQRLI-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)OC(=C(C)C)C(C)C |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
2,4-dimethylpen... CAS#:80239-20-9 |
| Literature: Igarashi, Mamoru; Sugihara, Yuichi; Fuchikami, Takamasa Tetrahedron Letters, 1999 , vol. 40, # 4 p. 711 - 714 |
|
~85%
2,4-dimethylpen... CAS#:80239-20-9 |
| Literature: Emde, Herbert; Goetz, Andreas; Hofmann, Karin; Simchen, Gerhard Liebigs Annalen der Chemie, 1981 , # 9 p. 1643 - 1657 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 4 | |
CAS#:994-30-9
CAS#:72458-54-9
CAS#:89056-09-7![[chlorosulfonyloxy(diethyl)silyl]ethane structure](https://image.chemsrc.com/caspic/133/89056-13-3.png)
CAS#:89056-13-3This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Silane,triethyl[[2-methyl-1-(1-methylethyl)-1-propenyl]oxy] |
| 2,4-Dimethyl-3-(triethylsiloxy)-2-penten |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: The English name of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane is 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane. |
| Q: What is the molecular weight of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: Molecular weight of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane is 228.44600. |
| Q: What English synonyms does 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane have? |
| A: English synonyms of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane: Silane,triethyl[[2-methyl-1-(1-methylethyl)-1-propenyl]oxy], 2,4-Dimethyl-3-(triethylsiloxy)-2-penten. |
| Q: What is the InChIKey of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: InChIKey of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane is UXXRCYQQOOQRLI-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 80239-20-9? |
| A: Chinese name of 80239-20-9 is 80239-20-9. |
| Q: What is the SMILES notation of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: SMILES notation of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane is CC[Si](CC)(CC)OC(=C(C)C)C(C)C. |
| Q: What are the downstream products of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: Related downstream products(CAS) of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane: 994-30-9;72458-54-9;89056-09-7;89056-13-3. |
| Q: What is the polar surface area (PSA) of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: Polar surface area (PSA) of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane is 9.23000. |
| Q: What is the molecular formula of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: Molecular formula of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane is C13H28OSi. |
| Q: What are the upstream materials of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane? |
| A: Related upstream materials(CAS) of 2,4-dimethylpent-2-en-3-yloxy(triethyl)silane: 617-86-7;565-80-0;79271-56-0. |