Triethylsilyl trifluoromethanesulfonate
Modify Date: 2026-07-01 20:44:07
Triethylsilyl trifluoromethanesulfonate structure
|
Common Name | Triethylsilyl trifluoromethanesulfonate | ||
|---|---|---|---|---|
| CAS Number | 79271-56-0 | Molecular Weight | 264.338 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 207.3±35.0 °C at 760 mmHg | |
| Molecular Formula | C7H15F3O3SSi | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 79.2±25.9 °C | |
| Symbol |
GHS05 |
Signal Word | Danger | |
| Name | Triethylsilyl Trifluoromethanesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 207.3±35.0 °C at 760 mmHg |
| Molecular Formula | C7H15F3O3SSi |
| Molecular Weight | 264.338 |
| Flash Point | 79.2±25.9 °C |
| Exact Mass | 264.046326 |
| PSA | 51.75000 |
| LogP | 4.13 |
| Vapour Pressure | 0.3±0.4 mmHg at 25°C |
| Index of Refraction | 1.399 |
| InChIKey | STMPXDBGVJZCEX-UHFFFAOYSA-N |
| SMILES | CC[Si](CC)(CC)OS(=O)(=O)C(F)(F)F |
| Symbol |
GHS05 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314 |
| Precautionary Statements | P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Faceshields;full-face respirator (US);Gloves;Goggles;multi-purpose combination respirator cartridge (US);type ABEK (EN14387) respirator filter |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R14;R34 |
| Safety Phrases | S26-S36/37/39-S45-S27 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | II |
| Hazard Class | 8 |
|
~82%
Triethylsilyl t... CAS#:79271-56-0 |
| Literature: Israel Journal of Chemistry, , vol. 39, # 2 p. 171 - 178 |
|
~%
Triethylsilyl t... CAS#:79271-56-0 |
| Literature: Journal of Organic Chemistry, , vol. 73, # 7 p. 2912 - 2915 |
|
~%
Triethylsilyl t... CAS#:79271-56-0 |
| Literature: Journal of the American Chemical Society, , vol. 129, # 17 p. 5587 - 5596 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
![R-2-[bis[3,5-bis(trifluoromethyl)phenyl][(triethylsilyl)oxy]Methyl]-Pyrrolidine structure](https://image.chemsrc.com/caspic/090/1061307-56-9.png)
CAS#:1061307-56-9
CAS#:14629-52-8
CAS#:23273-02-1![[Me2NH2]OTf structure](https://image.chemsrc.com/caspic/045/79430-76-5.png)
CAS#:79430-76-5
CAS#:1631-33-0
CAS#:91-01-0
CAS#:20098-55-9
CAS#:80239-20-9
CAS#:872839-39-9|
Aldrichimica Acta 17 , 72, (1984)
|
|
|
Synthesis , 1, (1982)
|
| MFCD00000407 |
| EINECS 279-124-4 |
| Methanesulfonic acid, 1,1,1-trifluoro-, triethylsilyl ester |
| 1,1,1-triethylsilyl trifluoromethanesulfonate |
| Triethylsilyl trifluoromethanesulfonate |