5,10-dihydroindolo[3,2-b]quinolin-11-one
![5,10-dihydroindolo[3,2-b]quinolin-11-one Structure](https://image.chemsrc.com/caspic/407/80289-15-2.png)
5,10-dihydroindolo[3,2-b]quinolin-11-one structure
|
Common Name | 5,10-dihydroindolo[3,2-b]quinolin-11-one | ||
|---|---|---|---|---|
| CAS Number | 80289-15-2 | Molecular Weight | 234.25300 | |
| Density | 1.369g/cm3 | Boiling Point | 488ºC at 760 mmHg | |
| Molecular Formula | C15H10N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 248.9ºC | |
Summary: 5,10-Dihydroindolo[3,2-b]quinolin-11-one (CAS: 80289-15-2), molecular formula: C15H10N2O, molecular weight: 234.25300. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5,10-dihydroindolo[3,2-b]quinolin-11-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 488ºC at 760 mmHg |
| Molecular Formula | C15H10N2O |
| Molecular Weight | 234.25300 |
| Flash Point | 248.9ºC |
| Exact Mass | 234.07900 |
| PSA | 48.65000 |
| LogP | 3.16260 |
| Index of Refraction | 1.748 |
| InChIKey | AETJISOJRRTLLJ-UHFFFAOYSA-N |
| SMILES | O=c1c2ccccc2[nH]c2c1[nH]c1ccccc12 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 1 | |
CAS#:118-92-3![5-benzoyl-5H-indolo[3,2-b]quinolin-11(10H)-one Structure](https://image.chemsrc.com/caspic/299/178884-05-4.png)
CAS#:178884-05-4
CAS#:40899-71-6
CAS#:552-89-6
CAS#:58585-02-7
CAS#:243-58-3This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Selectivity ratio of IC50 for human HepG2A16 cells to IC50 for Plasmodium falciparum ...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1260782
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 10H-indolo[3,2-b]quinolin-11(5H)-one |
| 5H-indolo[3,2-b]quinolin-11(10H)-one |
| quindolinone |
| 5,10-dihydro-indolo[3,2-b]quinolin-11-one |
| 5,5a,10,10a-tetrahydro-indolo[3,2-b]quinolin-11-one |
| 5H,10H,11H-indolo[3,2-b]quinolin-11-one |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: Polar surface area (PSA) of 5,10-dihydroindolo[3,2-b]quinolin-11-one is 48.65000. |
| Q: What is the CAS number of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: CAS number of 5,10-dihydroindolo[3,2-b]quinolin-11-one is 80289-15-2. |
| Q: What is the Chinese name of 80289-15-2? |
| A: Chinese name of 80289-15-2 is 80289-15-2. |
| Q: What are the upstream materials of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: Related upstream materials(CAS) of 5,10-dihydroindolo[3,2-b]quinolin-11-one: 118-92-3;178884-05-4;40899-71-6;552-89-6;58585-02-7. |
| Q: What are the downstream products of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: Related downstream products(CAS) of 5,10-dihydroindolo[3,2-b]quinolin-11-one: 243-58-3. |
| Q: What is the molecular formula of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: Molecular formula of 5,10-dihydroindolo[3,2-b]quinolin-11-one is C15H10N2O. |
| Q: What is the boiling point of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: Boiling point of 5,10-dihydroindolo[3,2-b]quinolin-11-one is 488ºC at 760 mmHg. |
| Q: What is the LogP of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: LogP of 5,10-dihydroindolo[3,2-b]quinolin-11-one is 3.16260. |
| Q: What is the SMILES notation of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: SMILES notation of 5,10-dihydroindolo[3,2-b]quinolin-11-one is O=c1c2ccccc2[nH]c2c1[nH]c1ccccc12. |
| Q: What is the InChIKey of 5,10-dihydroindolo[3,2-b]quinolin-11-one? |
| A: InChIKey of 5,10-dihydroindolo[3,2-b]quinolin-11-one is AETJISOJRRTLLJ-UHFFFAOYSA-N. |