phenyl 2,4-dichloro-5-sulphamoylbenzenesulphonate structure
|
Common Name | phenyl 2,4-dichloro-5-sulphamoylbenzenesulphonate | ||
|---|---|---|---|---|
| CAS Number | 80289-32-3 | Molecular Weight | 382.24000 | |
| Density | 1.62g/cm3 | Boiling Point | 587.8ºC at 760 mmHg | |
| Molecular Formula | C12H9Cl2NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 309.3ºC | |
| Name | phenyl 2,4-dichloro-5-sulfamoylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.62g/cm3 |
|---|---|
| Boiling Point | 587.8ºC at 760 mmHg |
| Molecular Formula | C12H9Cl2NO5S2 |
| Molecular Weight | 382.24000 |
| Flash Point | 309.3ºC |
| Exact Mass | 380.93000 |
| PSA | 120.29000 |
| LogP | 5.27040 |
| Index of Refraction | 1.631 |
| InChIKey | XIJVOPHKEWHUNN-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1cc(S(=O)(=O)Oc2ccccc2)c(Cl)cc1Cl |
|
~%
phenyl 2,4-dich... CAS#:80289-32-3 |
| Literature: Sturm; muschaweck; Hropot Journal of Medicinal Chemistry, 1983 , vol. 26, # 8 p. 1174 - 1187 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| EINECS 279-443-9 |
| Benzenesulfonic acid,5-(aminosulfonyl)-2,4-dichloro-,phenyl ester |
| PHENYL 2,4-DICHLORO-5-SULPHAMOYLBENZENESULFONATE |
| Phenyl 2,4-dichloro-5-sulphamoylbenzenesulphonate |