3-(4-methylphenyl)-2-phenylpyrimidin-4-one
3-(4-methylphenyl)-2-phenylpyrimidin-4-one structure
|
Common Name | 3-(4-methylphenyl)-2-phenylpyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 80306-49-6 | Molecular Weight | 262.30600 | |
| Density | 1.12g/cm3 | Boiling Point | 425.1ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-methylphenyl)-2-phenylpyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760 mmHg |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30600 |
| Flash Point | 210.9ºC |
| Exact Mass | 262.11100 |
| PSA | 34.89000 |
| LogP | 3.20790 |
| Index of Refraction | 1.612 |
| InChIKey | YAEJSSBATRPNEG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nccc2=O)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~70%
3-(4-methylphen... CAS#:80306-49-6 |
| Literature: Gupta; Saxena; Jain Synthesis, 1981 , vol. No. 11, p. 905 - 907 |
|
~72%
3-(4-methylphen... CAS#:80306-49-6 |
| Literature: Gupta, K. A.; Saxena, Anil K.; Jain, Padam C.; Dua, P. R.; Prasad, C. R.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 789 - 794 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 3-(4-methylphenyl)-2-phenyl-4(3H)-pyrimidinone |
| 4(3H)-Pyrimidinone,3-(4-methylphenyl)-2-phenyl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: Molecular weight of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is 262.30600. |
| Q: What is the InChIKey of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: InChIKey of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is YAEJSSBATRPNEG-UHFFFAOYSA-N. |
| Q: What is the boiling point of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: Boiling point of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is 425.1ºC at 760 mmHg. |
| Q: What are the upstream materials of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: Related upstream materials(CAS) of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one: 1859-00-3;623-47-2. |
| Q: What English synonyms does 3-(4-methylphenyl)-2-phenylpyrimidin-4-one have? |
| A: English synonyms of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one: 3-(4-methylphenyl)-2-phenyl-4(3H)-pyrimidinone, 4(3H)-Pyrimidinone,3-(4-methylphenyl)-2-phenyl. |
| Q: What is the polar surface area (PSA) of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: Polar surface area (PSA) of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is 34.89000. |
| Q: What is the LogP of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: LogP of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is 3.20790. |
| Q: What is the English name of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: The English name of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is 3-(4-methylphenyl)-2-phenylpyrimidin-4-one. |
| Q: What is the molecular formula of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: Molecular formula of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is C17H14N2O. |
| Q: What is the SMILES notation of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one? |
| A: SMILES notation of 3-(4-methylphenyl)-2-phenylpyrimidin-4-one is Cc1ccc(-n2c(-c3ccccc3)nccc2=O)cc1. |