3-(4-methylphenyl)-2-phenylpyrimidin-4-one structure
|
Common Name | 3-(4-methylphenyl)-2-phenylpyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 80306-49-6 | Molecular Weight | 262.30600 | |
| Density | 1.12g/cm3 | Boiling Point | 425.1ºC at 760 mmHg | |
| Molecular Formula | C17H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210.9ºC | |
| Name | 3-(4-methylphenyl)-2-phenylpyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.12g/cm3 |
|---|---|
| Boiling Point | 425.1ºC at 760 mmHg |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.30600 |
| Flash Point | 210.9ºC |
| Exact Mass | 262.11100 |
| PSA | 34.89000 |
| LogP | 3.20790 |
| Index of Refraction | 1.612 |
| InChIKey | YAEJSSBATRPNEG-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-n2c(-c3ccccc3)nccc2=O)cc1 |
|
~70%
3-(4-methylphen... CAS#:80306-49-6 |
| Literature: Gupta; Saxena; Jain Synthesis, 1981 , vol. No. 11, p. 905 - 907 |
|
~72%
3-(4-methylphen... CAS#:80306-49-6 |
| Literature: Gupta, K. A.; Saxena, Anil K.; Jain, Padam C.; Dua, P. R.; Prasad, C. R.; Anand, Nitya Indian Journal of Chemistry, Section B: Organic Chemistry Including Medicinal Chemistry, 1983 , vol. 22, # 8 p. 789 - 794 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3-(4-methylphenyl)-2-phenyl-4(3H)-pyrimidinone |
| 4(3H)-Pyrimidinone,3-(4-methylphenyl)-2-phenyl |