1,4-dihydro-2,6-dimethyl-4-(3-methylphenyl)-3,5-pyridinedicarboxylic acid dimethyl ester structure
|
Common Name | 1,4-dihydro-2,6-dimethyl-4-(3-methylphenyl)-3,5-pyridinedicarboxylic acid dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 80307-08-0 | Molecular Weight | 315.36400 | |
| Density | 1.139g/cm3 | Boiling Point | 438.5ºC at 760 mmHg | |
| Molecular Formula | C18H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 219ºC | |
| Name | dimethyl 2,6-dimethyl-4-(3-methylphenyl)-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.139g/cm3 |
|---|---|
| Boiling Point | 438.5ºC at 760 mmHg |
| Molecular Formula | C18H21NO4 |
| Molecular Weight | 315.36400 |
| Flash Point | 219ºC |
| Exact Mass | 315.14700 |
| PSA | 64.63000 |
| LogP | 2.90460 |
| Index of Refraction | 1.535 |
| InChIKey | GCIFMTLFBQGFRJ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C)NC(C)=C(C(=O)OC)C1c1cccc(C)c1 |
|
~44%
1,4-dihydro-2,6... CAS#:80307-08-0 |
| Literature: Coburn; Wierzba; Suto; Solo; Triggle Journal of Medicinal Chemistry, 1988 , vol. 31, # 11 p. 2103 - 2107 |
|
~28%
1,4-dihydro-2,6... CAS#:80307-08-0 |
| Literature: Filipan-Litvic, Mirela; Litvic, Mladen; Vinkovic, Vladimir Tetrahedron, 2008 , vol. 64, # 24 p. 5649 - 5656 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2,6-dimethyl-3,5-dimethoxycarbonyl-4-(3-methylphenyl)-1,4-dihydropyridine |
| 1,4-Dihydro-2,6-dimethyl-4-(3-methylphenyl)-3,5-pyridinedicarboxylic acid dimethyl ester |
| 2,6-dimethyl-3,5-dicarbomethoxy-4-(3-methylphenyl)-1,4-dihydropyridine |
| 3,5-Pyridinedicarboxylic acid,1,4-dihydro-2,6-dimethyl-4-(3-methylphenyl)-,dimethyl ester |
| DDMPC |
| 2,6-dimethyl-3,5-bis(methoxycarbonyl)-4-(3-methylphenyl)-1,4-dihydropyridine |