5,7,8,3′,4′,5′-Hexamethoxyflavone structure
|
Common Name | 5,7,8,3′,4′,5′-Hexamethoxyflavone | ||
|---|---|---|---|---|
| CAS Number | 80324-51-2 | Molecular Weight | 402.39500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5,7,8,3′,4′,5′-Hexamethoxyflavone5,7,8,3′,4′,5′-Hexamethoxyflavone is a flavonoid that can be isolated from the fresh ripe fruits of Murraya paniculata[1]. |
| Name | 5,7,8,3',4',5'-hexamethoxyflavone |
|---|---|
| Synonym | More Synonyms |
| Description | 5,7,8,3′,4′,5′-Hexamethoxyflavone is a flavonoid that can be isolated from the fresh ripe fruits of Murraya paniculata[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C21H22O8 |
|---|---|
| Molecular Weight | 402.39500 |
| Exact Mass | 402.13100 |
| PSA | 85.59000 |
| LogP | 3.51160 |
| InChIKey | QLVJRZMVFHRFAV-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2cc(=O)c3c(OC)cc(OC)c(OC)c3o2)cc(OC)c1OC |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 5,7,8-Trimethoxy-2-(3,4,5-trimethoxy-phenyl)-chromen-4-on |
| 5,7,8-trimethoxy-2-(3,4,5-trimethoxy-phenyl)-chromen-4-one |