Ganhuangemin structure
|
Common Name | Ganhuangemin | ||
|---|---|---|---|---|
| CAS Number | 80366-15-0 | Molecular Weight | 304.25 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 713.4±60.0 °C at 760 mmHg | |
| Molecular Formula | C15H12O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 273.8±26.4 °C | |
Use of Ganhuangemin2′,3,5,6′,7-Pentahydroxyflavanone (compound 4) is a flavonoid compound isolated from Scutellaria baicalensis roots[1]. |
| Name | 2',6'-Dihydroxypinobanksin |
|---|---|
| Synonym | More Synonyms |
| Description | 2′,3,5,6′,7-Pentahydroxyflavanone (compound 4) is a flavonoid compound isolated from Scutellaria baicalensis roots[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 713.4±60.0 °C at 760 mmHg |
| Molecular Formula | C15H12O7 |
| Molecular Weight | 304.25 |
| Flash Point | 273.8±26.4 °C |
| Exact Mass | 304.058289 |
| PSA | 127.45000 |
| LogP | 1.70 |
| Vapour Pressure | 0.0±2.4 mmHg at 25°C |
| Index of Refraction | 1.763 |
| InChIKey | NBQYBZYBTNQEQG-CABCVRRESA-N |
| SMILES | O=C1c2c(O)cc(O)cc2OC(c2c(O)cccc2O)C1O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2,6-Dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydro-4H-chromen-4-one |
| (2R,3R)-2-(2,6-Dihydroxyphenyl)-3,5,7-trihydroxy-2,3-dihydro-4H-chromen-4-one |
| 4H-1-Benzopyran-4-one, 2-(2,6-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy- |
| 4H-1-Benzopyran-4-one, 2-(2,6-dihydroxyphenyl)-2,3-dihydro-3,5,7-trihydroxy-, (2R,3R)- |