3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride structure
|
Common Name | 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride | ||
|---|---|---|---|---|
| CAS Number | 80466-78-0 | Molecular Weight | 194.63900 | |
| Density | 1.495g/cm3 | Boiling Point | 368ºC at 760 mmHg | |
| Molecular Formula | C5H7ClN2O2S | Melting Point | N/A | |
| MSDS | USA | Flash Point | 176.3ºC | |
| Name | 3,5-Dimethyl-1H-pyrazole-4-sulfonyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.495g/cm3 |
|---|---|
| Boiling Point | 368ºC at 760 mmHg |
| Molecular Formula | C5H7ClN2O2S |
| Molecular Weight | 194.63900 |
| Flash Point | 176.3ºC |
| Exact Mass | 193.99200 |
| PSA | 71.20000 |
| LogP | 2.03480 |
| Index of Refraction | 1.548 |
| InChIKey | NBGSZCQLPLYKJH-UHFFFAOYSA-N |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)Cl |
| Hazard Codes | C |
|---|
|
~48%
3,5-Dimethyl-1H... CAS#:80466-78-0 |
| Literature: Journal of Heterocyclic Chemistry, , vol. 18, p. 997 - 1006 |
|
~%
3,5-Dimethyl-1H... CAS#:80466-78-0 |
| Literature: US2013/324576 A1, ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| 3,5-dimethyl-1H-pyrazol-4-ylsulphonyl chloride |
| Pyrazole,4-chlorosulfonyl-3,5-dimethyl |
| 3,5-dimethylpyrazole-4-sulfonyl chloride |
| 3,5-dimethyl-1H-pyrazole-4-sulfonyl chloride hydrochloride |
| 1H-Pyrazole-4-sulfonylchloride,3,5-dimethyl |
| (3,5-dimethylpyrazol-4-yl)chlorosulfone |
| 3,5-Dimethyl-1H-pyrazol-4-sulfonylchlorid |
| 3,5-dimethyl-pyrazole-4-sulphonyl chloride |