Benzaldehyde,3-hydroxy-4-methoxy-5-nitro- structure
|
Common Name | Benzaldehyde,3-hydroxy-4-methoxy-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 80547-69-9 | Molecular Weight | 197.14500 | |
| Density | 1.456g/cm3 | Boiling Point | 373ºC at 760 mmHg | |
| Molecular Formula | C8H7NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.4ºC | |
| Name | 3-hydroxy-4-methoxy-5-nitrobenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.456g/cm3 |
|---|---|
| Boiling Point | 373ºC at 760 mmHg |
| Molecular Formula | C8H7NO5 |
| Molecular Weight | 197.14500 |
| Flash Point | 179.4ºC |
| Exact Mass | 197.03200 |
| PSA | 92.35000 |
| LogP | 1.64470 |
| Index of Refraction | 1.629 |
| InChIKey | PYLFOUFNUBQBGP-UHFFFAOYSA-N |
| SMILES | COc1c(O)cc(C=O)cc1[N+](=O)[O-] |
| HS Code | 2913000090 |
|---|
|
~54%
Benzaldehyde,3-... CAS#:80547-69-9 |
| Literature: Augusto; Rodrigues; De Oliveira Filho, Antonio Pedro; Moran, Paulo J. S.; Custodio, Rogerio Tetrahedron, 1999 , vol. 55, # 22 p. 6733 - 6738 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| HS Code | 2913000090 |
|---|---|
| Summary | HS: 2913000090 halogenated, sulphonated, nitrated or nitrosated derivatives of products of heading 2912 Educational tariff:17.0% Tax rebate rate:9.0% Regulatory conditions:none Most favored nation tariff:5.5% General tariff:30.0% |
| 3-hydroxy-4-methoxybenzaldehyde |
| 3-Hydroxy-4-methoxy-5-nitro-benzaldehyd |
| HMNB |
| 3-hydroxy-4-methoxy-5-nitro-benzaldehyde |
| 5-nitroisovanillin |