2-(chloromethyl)-5-methyl-3H-benzoimidazole structure
|
Common Name | 2-(chloromethyl)-5-methyl-3H-benzoimidazole | ||
|---|---|---|---|---|
| CAS Number | 80567-68-6 | Molecular Weight | 180.63400 | |
| Density | 1.298g/cm3 | Boiling Point | 381.1ºC at 760 mmHg | |
| Molecular Formula | C9H9ClN2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.2ºC | |
| Name | 2-(chloromethyl)-6-methyl-1H-benzimidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.298g/cm3 |
|---|---|
| Boiling Point | 381.1ºC at 760 mmHg |
| Molecular Formula | C9H9ClN2 |
| Molecular Weight | 180.63400 |
| Flash Point | 216.2ºC |
| Exact Mass | 180.04500 |
| PSA | 28.68000 |
| LogP | 2.61010 |
| Index of Refraction | 1.657 |
| InChIKey | CBRYYRQILDVDHH-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C1)N=C(N2)CCl |
| HS Code | 2933990090 |
|---|
|
~97%
2-(chloromethyl... CAS#:80567-68-6 |
| Literature: Wilson; Hunt Australian Journal of Chemistry, 1983 , vol. 36, # 11 p. 2317 - 2325 |
|
~%
2-(chloromethyl... CAS#:80567-68-6 |
| Literature: Tatsuoka; Hitomi Yakugaku Zasshi, 1951 , vol. 71, p. 871,873,874 Chem.Abstr., 1952 , p. 4002 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-Chloromethyl-6-methyl-1H-benzoimidazole |
| 2-Chloromethyl-5-methyl-1H-benzoimidazole |