3-(3-methylphenyl)-1H-pyrazol-5-amine structure
|
Common Name | 3-(3-methylphenyl)-1H-pyrazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 80568-96-3 | Molecular Weight | 173.214 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 430.2±33.0 °C at 760 mmHg | |
| Molecular Formula | C10H11N3 | Melting Point | 86-89ºC | |
| MSDS | Chinese USA | Flash Point | 243.8±12.6 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-(3-methylphenyl)-1H-pyrazol-3-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 430.2±33.0 °C at 760 mmHg |
| Melting Point | 86-89ºC |
| Molecular Formula | C10H11N3 |
| Molecular Weight | 173.214 |
| Flash Point | 243.8±12.6 °C |
| Exact Mass | 173.095291 |
| PSA | 54.70000 |
| LogP | 1.79 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.644 |
| InChIKey | KRRSPSCILJPKSA-UHFFFAOYSA-N |
| SMILES | Cc1cccc(-c2cc(N)n[nH]2)c1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P261-P280-P305 + P351 + P338 |
| Hazard Codes | Xi |
| RIDADR | NONH for all modes of transport |
| HS Code | 2933199090 |
|
~%
3-(3-methylphen... CAS#:80568-96-3 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 14, # 22 p. 7501 - 7511 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(3-methylphenyl)-1H-pyrazol-5-amine |
| 3-(3-methylphenyl)pyrazole-5-ylamine |
| 3-(m-Tolyl)-1H-pyrazole-5-carboxamide |
| 5-(3-Methylphenyl)-1H-pyrazol-3-amine |
| 5-m-Tolyl-2H-pyrazol-3-ylamine |
| 1H-Pyrazol-5-amine, 3-(3-methylphenyl)- |
| 1H-Pyrazol-3-amine, 5-(3-methylphenyl)- |
| 3-m-tolyl-1h-pyrazol-5-amine |
| 3-Amino-5-(3-methylphenyl)-1H-pyrazole |