10-methyl-10-deazaaminopterin structure
|
Common Name | 10-methyl-10-deazaaminopterin | ||
|---|---|---|---|---|
| CAS Number | 80576-77-8 | Molecular Weight | 453.451 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C21H23N7O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 10-methyl-10-deazaaminopterin10-Methyl-10-deazaaminopterin is a folate analog and an antifolate. 10-Methyl-10-deazaaminopterin can be used for the research of cancer[1]. |
| Name | N-{4-[1-(2,4-Diamino-6-pteridinyl)-2-propanyl]benzoyl}-L-glutamic acid |
|---|---|
| Synonym | More Synonyms |
| Description | 10-Methyl-10-deazaaminopterin is a folate analog and an antifolate. 10-Methyl-10-deazaaminopterin can be used for the research of cancer[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C21H23N7O5 |
| Molecular Weight | 453.451 |
| Exact Mass | 453.176056 |
| LogP | 0.28 |
| Index of Refraction | 1.699 |
| InChIKey | MQISJAZESFPIPJ-SBNLOKMTSA-N |
| SMILES | CC(Cc1cnc2nc(N)nc(N)c2n1)c1ccc(C(=O)NC(CCC(=O)O)C(=O)O)cc1 |
| L-Glutamic acid, N-[4-[2-(2,4-diamino-6-pteridinyl)-1-methylethyl]benzoyl]- |
| N-{4-[1-(2,4-Diamino-6-pteridinyl)-2-propanyl]benzoyl}-L-glutamic acid |