2-Naphthalenamine,1,3,4,5,6,7,8-heptafluoro-N-(2,3,4,5,6-pentafluorophenyl)- structure
|
Common Name | 2-Naphthalenamine,1,3,4,5,6,7,8-heptafluoro-N-(2,3,4,5,6-pentafluorophenyl)- | ||
|---|---|---|---|---|
| CAS Number | 80588-48-3 | Molecular Weight | 435.16700 | |
| Density | 1.812g/cm3 | Boiling Point | 264.8ºC at 760mmHg | |
| Molecular Formula | C16HF12N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 113.9ºC | |
| Name | 1,3,4,5,6,7,8-heptafluoro-N-(2,3,4,5,6-pentafluorophenyl)naphthalen-2-amine |
|---|
| Density | 1.812g/cm3 |
|---|---|
| Boiling Point | 264.8ºC at 760mmHg |
| Molecular Formula | C16HF12N |
| Molecular Weight | 435.16700 |
| Flash Point | 113.9ºC |
| Exact Mass | 434.99200 |
| PSA | 12.03000 |
| LogP | 6.32560 |
| Index of Refraction | 1.523 |
| InChIKey | WDUOSSHHRIWPRO-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c(Nc2c(F)c(F)c3c(F)c(F)c(F)c(F)c3c2F)c(F)c1F |
|
~28%
2-Naphthalenami... CAS#:80588-48-3 |
| Literature: Vlasov, V. M.; Yakobson, G. G. Journal of Organic Chemistry USSR (English Translation), 1981 , vol. 17, p. 1955 - 1963 Zhurnal Organicheskoi Khimii, 1981 , vol. 17, # 10 p. 2192 - 2201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |