Octafluoronaphthalene
Octafluoronaphthalene structure
|
Common Name | Octafluoronaphthalene | ||
|---|---|---|---|---|
| CAS Number | 313-72-4 | Molecular Weight | 272.094 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 237.5±35.0 °C at 760 mmHg | |
| Molecular Formula | C10F8 | Melting Point | 87-88 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 74.3±17.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1,2,3,4,5,6,7,8-octafluoronaphthalene |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 237.5±35.0 °C at 760 mmHg |
| Melting Point | 87-88 °C(lit.) |
| Molecular Formula | C10F8 |
| Molecular Weight | 272.094 |
| Flash Point | 74.3±17.7 °C |
| Exact Mass | 271.987213 |
| LogP | 3.61 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | JDCMOHAFGDQQJX-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S62-S61-S36/37-S33-S29-S16-S9 |
| RIDADR | UN 1208 3/PG 2 |
| WGK Germany | 3 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 8 | |
|---|---|
| DownStream 9 | |
CAS#:306-94-5
CAS#:71715-93-0![hexadecafluoro-bicyclo[4.4.0]dec-1(6)-ene Structure](https://image.chemsrc.com/caspic/467/54939-04-7.png)
CAS#:54939-04-7
CAS#:115028-85-8
CAS#:75-43-4
CAS#:36954-58-2
CAS#:36773-80-5
CAS#:87228-43-1
CAS#:95-94-3
CAS#:608-93-5
CAS#:13772-77-5
CAS#:28750-05-2
CAS#:652-03-9
CAS#:727-49-1
CAS#:124017-53-4
CAS#:1024-60-8This table lists relevant public references with title, journal and publication metadata for this compound.
|
Gas chromatography with parallel hard and soft ionization mass spectrometry.
Rapid Commun. Mass Spectrom. 29(1) , 91-9, (2014) Mass spectrometric identification of compounds in chromatography can be obtained from molecular masses from soft ionization mass spectrometry techniques such as field ionization (FI) and fragmentation... |
|
|
Octafluoronaphthalene-diphenylacetylene (1/1).
Acta Crystallogr. C 57(Pt 7) , 870-2, (2001) The structure of the title complex, C10F8*C14H10, comprises mixed stacks of alternating diphenylacetylene and octafluoronaphthalene molecules, both lying at inversion centres and parallel to within 8.... |
|
|
Amination of octafluoronaphthalene in liquid ammonia: 2, 6-and 2, 7-Diaminohexafluoronaphthalenes selective preparation.
J. Fluor. Chem. 129(4) , 253-60, (2008)
|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Naphthalene,octafluoro |
| Octafluoronaphthalene |
| octafluoronapthalene |
| MFCD00014307 |
| perfluoronaphthelene |
| octafluoronaphtalene |
| Perfluoronaphthalene |
| EINECS 206-239-9 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: CAS number of 1,2,3,4,5,6,7,8-octafluoronaphthalene is 313-72-4. |
| Q: What is the safety information for 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: Safety information for 1,2,3,4,5,6,7,8-octafluoronaphthalene: S26-S36-S62-S61-S36/37-S33-S29-S16-S9. |
| Q: What is the English name of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: The English name of 1,2,3,4,5,6,7,8-octafluoronaphthalene is 1,2,3,4,5,6,7,8-octafluoronaphthalene. |
| Q: What is the SMILES notation of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: SMILES notation of 1,2,3,4,5,6,7,8-octafluoronaphthalene is Fc1c(F)c(F)c2c(F)c(F)c(F)c(F)c2c1F. |
| Q: What is the molecular formula of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: Molecular formula of 1,2,3,4,5,6,7,8-octafluoronaphthalene is C10F8. |
| Q: What is the boiling point of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: Boiling point of 1,2,3,4,5,6,7,8-octafluoronaphthalene is 237.5±35.0 °C at 760 mmHg. |
| Q: What are the upstream materials of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: Related upstream materials(CAS) of 1,2,3,4,5,6,7,8-octafluoronaphthalene: 306-94-5;71715-93-0;54939-04-7;115028-85-8;75-43-4;36954-58-2;36773-80-5;87228-43-1. |
| Q: What is the melting point of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: Melting point of 1,2,3,4,5,6,7,8-octafluoronaphthalene is 87-88 °C(lit.). |
| Q: What English synonyms does 1,2,3,4,5,6,7,8-octafluoronaphthalene have? |
| A: English synonyms of 1,2,3,4,5,6,7,8-octafluoronaphthalene: Naphthalene,octafluoro, Octafluoronaphthalene, octafluoronapthalene, MFCD00014307, perfluoronaphthelene, octafluoronaphtalene, Perfluoronaphthalene, EINECS 206-239-9. |
| Q: What is the molecular weight of 1,2,3,4,5,6,7,8-octafluoronaphthalene? |
| A: Molecular weight of 1,2,3,4,5,6,7,8-octafluoronaphthalene is 272.094. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |
| Henan Tianfu Chemical Co., Ltd. |