Captopril EP Impurity B structure
|
Common Name | Captopril EP Impurity B | ||
|---|---|---|---|---|
| CAS Number | 80629-35-2 | Molecular Weight | 264.11600 | |
| Density | 1.555±0.06 g/cm3 (20 ºC 760 Torr) | Boiling Point | N/A | |
| Molecular Formula | C9H14BrNO3 | Melting Point | 110-114 ºC | |
| MSDS | N/A | Flash Point | N/A | |
Use of Captopril EP Impurity BCaptopril EP Impurity B is an impurity of Captopril. Captopril (SQ-14534), antihypertensive agent, is a thiol-containing competitive, orally active angiotensin-converting enzyme (ACE) inhibitor (IC50=0.025 μM)[1][2][3]. |
| Name | 1-(3-bromo-2S-methylpropionyl)-pyrrolidine-2S-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Captopril EP Impurity B is an impurity of Captopril. Captopril (SQ-14534), antihypertensive agent, is a thiol-containing competitive, orally active angiotensin-converting enzyme (ACE) inhibitor (IC50=0.025 μM)[1][2][3]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.555±0.06 g/cm3 (20 ºC 760 Torr) |
|---|---|
| Melting Point | 110-114 ºC |
| Molecular Formula | C9H14BrNO3 |
| Molecular Weight | 264.11600 |
| Exact Mass | 263.01600 |
| PSA | 57.61000 |
| LogP | 1.03090 |
| InChIKey | SJYSAVFKJLHJHP-RQJHMYQMSA-N |
| SMILES | CC(CBr)C(=O)N1CCCC1C(=O)O |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| 1-[(2S)-3-Bromo-2-methyl-1-oxopropyl]-L-proline |
| Captopril EP Impurity B |
| Captopril Impurity 2 |