5-methyl-1-[3-(6-oxo-3H-purin-9-yl)propyl]pyrimidine-2,4-dione structure
|
Common Name | 5-methyl-1-[3-(6-oxo-3H-purin-9-yl)propyl]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 80655-37-4 | Molecular Weight | 302.28900 | |
| Density | 1.6g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-1-[3-(6-oxo-3H-purin-9-yl)propyl]pyrimidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6g/cm3 |
|---|---|
| Molecular Formula | C13H14N6O3 |
| Molecular Weight | 302.28900 |
| Exact Mass | 302.11300 |
| PSA | 118.43000 |
| Index of Refraction | 1.76 |
| InChIKey | AKUXYWQAVMRRNV-UHFFFAOYSA-N |
| SMILES | Cc1cn(CCCn2cnc3c(=O)[nH]cnc32)c(=O)[nH]c1=O |
|
~30%
5-methyl-1-[3-(... CAS#:80655-37-4 |
| Literature: Wenska; Paszyc 1981 , vol. 36, # 12 p. 1628 - 1631 |
|
~69%
5-methyl-1-[3-(... CAS#:80655-37-4 |
| Literature: Wenska, Grazyna Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1157 - 1161 |
|
~9%
5-methyl-1-[3-(... CAS#:80655-37-4 |
| Literature: Wenska, Grazyna Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1157 - 1161 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 9-<3-propyl-(thym-1-yl)>-hypoxanthine |
| 9-<3-(thym-1-yl)propyl>hypoxanthine |