5-methyl-1-(3-purin-9-ylpropyl)pyrimidine-2,4-dione structure
|
Common Name | 5-methyl-1-(3-purin-9-ylpropyl)pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 80655-39-6 | Molecular Weight | 286.28900 | |
| Density | 1.5g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C13H14N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-methyl-1-(3-purin-9-ylpropyl)pyrimidine-2,4-dione |
|---|
| Density | 1.5g/cm3 |
|---|---|
| Molecular Formula | C13H14N6O2 |
| Molecular Weight | 286.28900 |
| Exact Mass | 286.11800 |
| PSA | 98.46000 |
| LogP | 0.07500 |
| Index of Refraction | 1.735 |
| InChIKey | YPYYELYRORTPAC-UHFFFAOYSA-N |
| SMILES | Cc1cn(CCCn2cnc3cncnc32)c(=O)[nH]c1=O |
|
~45%
5-methyl-1-(3-p... CAS#:80655-39-6 |
| Literature: Wenska; Paszyc 1981 , vol. 36, # 12 p. 1628 - 1631 |
|
~29%
5-methyl-1-(3-p... CAS#:80655-39-6 |
| Literature: Wenska, Grazyna Polish Journal of Chemistry, 1981 , vol. 55, # 5 p. 1157 - 1161 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |