2-methyl-1,3,5-trinitrobenzene,[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate structure
|
Common Name | 2-methyl-1,3,5-trinitrobenzene,[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate | ||
|---|---|---|---|---|
| CAS Number | 8066-33-9 | Molecular Weight | 543.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13N7O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-methyl-1,3,5-trinitrobenzene,[3-nitrooxy-2,2-bis(nitrooxymethyl)propyl] nitrate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13N7O18 |
|---|---|
| Molecular Weight | 543.26800 |
| Exact Mass | 543.03200 |
| PSA | 357.66000 |
| LogP | 4.18800 |
| InChIKey | HZTVIZREFBBQMG-UHFFFAOYSA-N |
| SMILES | Cc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-].O=[N+]([O-])OCC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| 1,3-Propanediol,2,2-bis((nitrooxy)methyl)-,dinitrate (ester),mixt. with 2-methyl-1,3,5-trinitrobenzene |
| Anzomex PowerPlus P |
| Pentolite,dry or wetted with |
| PETN / TNT |
| Pentaerythritol tetranitrate mixture with trinitrotoluene |
| Pentolite |
| PETN mixture with TNT |
| UN0151 |