(E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane structure
|
Common Name | (E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane | ||
|---|---|---|---|---|
| CAS Number | 8069-49-6 | Molecular Weight | 275.34500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4H4Cl5NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (E)-1,3-dichloroprop-1-ene,trichloro(nitro)methane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C4H4Cl5NO2 |
|---|---|
| Molecular Weight | 275.34500 |
| Exact Mass | 272.86800 |
| PSA | 45.82000 |
| LogP | 4.09170 |
| InChIKey | FKWUMIPPXHMPKY-TYYBGVCCSA-N |
| SMILES | ClC=CCCl.O=[N+]([O-])C(Cl)(Cl)Cl |
| Methane,trichloronitro-,mixt. with 1,3-dichloro-1-propene |
| 1,3-Dichloro-1-propene mixt. with trichloronitromethane |
| 1-Propene,1,3-dichloro-,mixt. with trichloronitromethane |