diethyl 2,5-diaminothiophene-3,4-dicarboxylate structure
|
Common Name | diethyl 2,5-diaminothiophene-3,4-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 80691-81-2 | Molecular Weight | 258.29400 | |
| Density | 1.343g/cm3 | Boiling Point | 403.3ºC at 760 mmHg | |
| Molecular Formula | C10H14N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | diethyl 2,5-diaminothiophene-3,4-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.343g/cm3 |
|---|---|
| Boiling Point | 403.3ºC at 760 mmHg |
| Molecular Formula | C10H14N2O4S |
| Molecular Weight | 258.29400 |
| Flash Point | 197.7ºC |
| Exact Mass | 258.06700 |
| PSA | 132.88000 |
| LogP | 2.42830 |
| Index of Refraction | 1.601 |
| InChIKey | UCZCHDINMZWYIQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1c(N)sc(N)c1C(=O)OCC |
| HS Code | 2934999090 |
|---|
|
~30%
diethyl 2,5-dia... CAS#:80691-81-2 |
| Literature: Gewald, Karl; Martin, Andreas Journal fuer Praktische Chemie (Leipzig), 1981 , vol. 323, # 5 p. 843 - 846 |
|
~%
diethyl 2,5-dia... CAS#:80691-81-2 |
| Literature: Journal of Medicinal Chemistry, , vol. 31, # 9 p. 1738 - 1745 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2,5-Diaminothiophen-3,4-dicarbonsaeurediethylester |
| 2,5-diaminothiophene-3,4-carboxylic acid diethyl ester |
| 2,5-DIAMINOTHIOPHENE-3,4-DICARBOXYLIC ACID DIETHYL ESTER |