1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane
1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane structure
|
Common Name | 1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane | ||
|---|---|---|---|---|
| CAS Number | 807-28-3 | Molecular Weight | 410.655 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 441.4±18.0 °C at 760 mmHg | |
| Molecular Formula | C26H26OSi2 | Melting Point | 46-49ºC | |
| MSDS | N/A | Flash Point | 181.0±21.6 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 441.4±18.0 °C at 760 mmHg |
| Melting Point | 46-49ºC |
| Molecular Formula | C26H26OSi2 |
| Molecular Weight | 410.655 |
| Flash Point | 181.0±21.6 °C |
| Exact Mass | 410.152222 |
| PSA | 9.23000 |
| LogP | 9.96 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | RFGGTTPASBFBTB-UHFFFAOYSA-N |
| SMILES | C[Si](O[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36 |
| WGK Germany | 3 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane |
| Disiloxane,1,3-dimethyl-1,1,3,3-tetraphenyl |
| Ph2MeSiOSiMePh2 |
| 1,3-Dimethyl-1,1,3,3-tetraphenyldisiloxane |
| tetraphenyldimethyldisiloxane |
| 1,3-dimethyltetraphenyldisiloxane |
| EINECS 212-361-3 |
| 1,1,3,3-TETRAPHENYLDIMETHYLDISILOXANE |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: Boiling point of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is 441.4±18.0 °C at 760 mmHg. |
| Q: What English synonyms does methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane have? |
| A: English synonyms of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane: 1,1,3,3-Tetraphenyl-1,3-dimethyldisiloxane, Disiloxane,1,3-dimethyl-1,1,3,3-tetraphenyl, Ph2MeSiOSiMePh2, 1,3-Dimethyl-1,1,3,3-tetraphenyldisiloxane, tetraphenyldimethyldisiloxane, 1,3-dimethyltetraphenyldisiloxane, EINECS 212-361-3, 1,1,3,3-TETRAPHENYLDIMETHYLDISILOXANE. |
| Q: What is the LogP of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: LogP of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is 9.96. |
| Q: What is the SMILES notation of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: SMILES notation of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is C[Si](O[Si](C)(c1ccccc1)c1ccccc1)(c1ccccc1)c1ccccc1. |
| Q: What is the English name of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: The English name of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane. |
| Q: What is the molecular formula of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: Molecular formula of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is C26H26OSi2. |
| Q: What is the CAS number of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: CAS number of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is 807-28-3. |
| Q: What is the melting point of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: Melting point of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is 46-49ºC. |
| Q: What is the InChIKey of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: InChIKey of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is RFGGTTPASBFBTB-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane? |
| A: Polar surface area (PSA) of methyl-[methyl(diphenyl)silyl]oxy-diphenylsilane is 9.23000. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |