Furan,2-nitro-5-[2-(4-nitrophenyl)-1-[(trichloromethyl)sulfonyl]ethenyl]- structure
|
Common Name | Furan,2-nitro-5-[2-(4-nitrophenyl)-1-[(trichloromethyl)sulfonyl]ethenyl]- | ||
|---|---|---|---|---|
| CAS Number | 80733-64-8 | Molecular Weight | 441.62800 | |
| Density | 1.737g/cm3 | Boiling Point | 552.5ºC at 760mmHg | |
| Molecular Formula | C13H7Cl3N2O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 288ºC | |
| Name | 2-nitro-5-[(Z)-2-(4-nitrophenyl)-1-(trichloromethylsulfonyl)ethenyl]furan |
|---|
| Density | 1.737g/cm3 |
|---|---|
| Boiling Point | 552.5ºC at 760mmHg |
| Molecular Formula | C13H7Cl3N2O7S |
| Molecular Weight | 441.62800 |
| Flash Point | 288ºC |
| Exact Mass | 439.90400 |
| PSA | 147.30000 |
| LogP | 6.46380 |
| Index of Refraction | 1.651 |
| InChIKey | WDSLVZYJBYPJTE-XFFZJAGNSA-N |
| SMILES | O=[N+]([O-])c1ccc(C=C(c2ccc([N+](=O)[O-])o2)S(=O)(=O)C(Cl)(Cl)Cl)cc1 |
|
~88%
Furan,2-nitro-5... CAS#:80733-64-8 |
| Literature: Prousek, Josef; Jurasek, Adolf; Kovac, Jaroslav Collection of Czechoslovak Chemical Communications, 1980 , vol. 45, # 6 p. 1704 - 1714 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |