2,3,6,7,10,11-HEXAMETHOXYTRIPHENYLENE structure
|
Common Name | 2,3,6,7,10,11-HEXAMETHOXYTRIPHENYLENE | ||
|---|---|---|---|---|
| CAS Number | 808-57-1 | Molecular Weight | 408.444 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 578.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C24H24O6 | Melting Point | 310-317ºC | |
| MSDS | N/A | Flash Point | 235.8±28.6 °C | |
| Name | 2,3,6,7,10,11-Hexamethoxytriphenylene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 578.6±45.0 °C at 760 mmHg |
| Melting Point | 310-317ºC |
| Molecular Formula | C24H24O6 |
| Molecular Weight | 408.444 |
| Flash Point | 235.8±28.6 °C |
| Exact Mass | 408.157288 |
| PSA | 55.38000 |
| LogP | 5.12 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | TXROZCSFVVIBFI-UHFFFAOYSA-N |
| SMILES | COc1cc2c3cc(OC)c(OC)cc3c3cc(OC)c(OC)cc3c2cc1OC |
| Safety Phrases | 24/25 |
|---|---|
| HS Code | 2909309090 |
| Precursor 9 | |
|---|---|
| DownStream 5 | |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| MFCD00075571 |
| Triphenylene, 2,3,6,7,10,11-hexamethoxy- |
| 2,3,6,7,10,11-HEXAMETHOXYTRIPHENYLENE |